CAS 959083-28-4

α-2-Furanyl-2-pyridinemethanol

Description:

α-2-Furanyl-2-pyridinemethanol, identified by its CAS number 959083-28-4, is a chemical compound that features a fused structure comprising a furan ring and a pyridine moiety, along with a hydroxymethyl group. This compound is characterized by its potential applications in medicinal chemistry, particularly due to the presence of both heterocyclic rings, which can enhance biological activity and interaction with various biological targets. The furan ring contributes to its reactivity and potential for forming derivatives, while the pyridine component can influence its solubility and electronic properties. The hydroxymethyl group may also play a crucial role in hydrogen bonding and molecular interactions. Overall, α-2-Furanyl-2-pyridinemethanol is of interest for its structural features that may lead to diverse pharmacological activities, making it a candidate for further research in drug development and synthesis. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined through experimental methods or detailed literature review.

Formula: C₁₀H₉NO₂

InChI: InChI=1S/C10H9NO2/c12-10(9-5-3-7-13-9)8-4-1-2-6-11-8/h1-7,10,12H

InChI key: InChIKey=XMNVKPCEQRQUGA-UHFFFAOYSA-N

SMILES: C(O)(C1=CC=CO1)C2=CC=CC=N2

Synonyms:

• α-2-Furanyl-2-pyridinemethanol
• (Furan-2-yl)(pyridin-2-yl)methanol
• 2-Pyridinemethanol, α-2-furanyl-
• 2-Furyl-(2-pyridyl)methanol