
CAS 959140-90-0
:1-(3-Chlorophenyl)cyclohexanamine
Description:
1-(3-Chlorophenyl)cyclohexanamine, identified by its CAS number 959140-90-0, is an organic compound characterized by a cyclohexane ring substituted with an amine group and a chlorophenyl group. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may influence biological activity. The presence of the chlorophenyl moiety can enhance lipophilicity, potentially affecting the compound's pharmacokinetics and interactions with biological targets. Additionally, the amine functional group may participate in hydrogen bonding, influencing solubility and reactivity. As with many amines, it may exhibit basic properties, allowing it to form salts with acids. Safety and handling precautions are essential, as with any chemical substance, to mitigate risks associated with toxicity or reactivity. Overall, 1-(3-Chlorophenyl)cyclohexanamine represents a compound of interest in chemical research and development.
Formula:C12H16ClN
InChI:InChI=1S/C12H16ClN/c13-11-6-4-5-10(9-11)12(14)7-2-1-3-8-12/h4-6,9H,1-3,7-8,14H2
InChI key:InChIKey=GUAOSMXRCCWTIY-UHFFFAOYSA-N
SMILES:NC1(C2=CC(Cl)=CC=C2)CCCCC1
Synonyms:- Cyclohexanamine, 1-(3-chlorophenyl)-
- 1-(3-Chlorophenyl)cyclohexanamine
- 1-(3-Chlorophenyl)cyclohexan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.