CAS 959235-79-1
:1-Isobutyl-7-nitro-1,2,3,4-tetrahydroquinoline
Description:
1-Isobutyl-7-nitro-1,2,3,4-tetrahydroquinoline is a chemical compound characterized by its unique structure, which includes a tetrahydroquinoline core with an isobutyl group and a nitro substituent. This compound typically exhibits properties associated with both nitrogen-containing heterocycles and aliphatic side chains. The presence of the nitro group suggests potential reactivity, particularly in electrophilic substitution reactions, while the tetrahydroquinoline framework may contribute to its biological activity. The isobutyl group can influence the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. Additionally, the compound's molecular structure may impart specific stereochemical characteristics, which can be crucial for its interaction with biological targets. Overall, 1-Isobutyl-7-nitro-1,2,3,4-tetrahydroquinoline represents a class of compounds that may have significant implications in drug development and chemical research.
Formula:C13H18N2O2
InChI:InChI=1/C13H18N2O2/c1-10(2)9-14-7-3-4-11-5-6-12(15(16)17)8-13(11)14/h5-6,8,10H,3-4,7,9H2,1-2H3
SMILES:CC(C)CN1CCCc2ccc(cc12)N(=O)=O
Synonyms:- 1-(2-Methylpropyl)-7-nitro-1,2,3,4-tetrahydroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
