CAS 959236-14-7
:7-Fluoroindole-3-acetonitrile
Description:
7-Fluoroindole-3-acetonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 7-position of the indole ring introduces unique electronic and steric properties, potentially influencing its reactivity and interactions. The acetonitrile functional group at the 3-position contributes to its polar character, making it soluble in various organic solvents. This compound is of interest in medicinal chemistry and drug development due to its potential biological activity, particularly in the context of targeting specific receptors or enzymes. Its molecular structure allows for various synthetic modifications, which can enhance its pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atom, which can affect its behavior in chemical reactions and interactions with biological systems. Overall, 7-Fluoroindole-3-acetonitrile represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C10H7FN2
InChI:InChI=1/C10H7FN2/c11-9-3-1-2-8-7(4-5-12)6-13-10(8)9/h1-3,6,13H,4H2
SMILES:c1cc2c(CC#N)c[nH]c2c(c1)F
Synonyms:- (7-Fluoro-1H-indol-3-yl)acetonitrile
- 1H-indole-3-acetonitrile, 7-fluoro-2-(7-fluoro-1H-indol-3-yl)acetonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
