CymitQuimica logo

CAS 959236-36-3

:

4-(Trifluoromethyl)-1H-indole-3-acetic acid

Description:
4-(Trifluoromethyl)-1H-indole-3-acetic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a trifluoromethyl group (-CF3) at the 4-position of the indole ring significantly influences its chemical properties, enhancing its lipophilicity and potentially affecting its biological activity. The acetic acid functional group at the 3-position contributes to its acidity and reactivity, making it a potential candidate for various applications in medicinal chemistry and agrochemicals. This compound may exhibit unique interactions with biological targets due to the electron-withdrawing nature of the trifluoromethyl group, which can modulate the electronic properties of the indole moiety. Additionally, its structural features suggest potential uses in drug development, particularly in the design of compounds with specific pharmacological profiles. As with many fluorinated compounds, it may also exhibit distinct solubility and stability characteristics compared to its non-fluorinated analogs.
Formula:C11H8F3NO2
InChI:InChI=1S/C11H8F3NO2/c12-11(13,14)7-2-1-3-8-10(7)6(5-15-8)4-9(16)17/h1-3,5,15H,4H2,(H,16,17)
InChI key:InChIKey=UXRJBWIYZWRBBW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C2C(CC(O)=O)=CNC2=CC=C1
Synonyms:
  • 2-[4-(Trifluoromethyl)-1H-indol-3-yl]acetic acid
  • 4-(Trifluoromethyl)-1H-indole-3-acetic acid
  • 1H-Indole-3-acetic acid, 4-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.