CAS 959236-54-5
:4-(Trifluoromethoxy)-1H-indole-2,3-dione
Description:
4-(Trifluoromethoxy)-1H-indole-2,3-dione, with the CAS number 959236-54-5, is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a trifluoromethoxy group, which significantly influences its chemical properties, including its reactivity and solubility. The presence of the trifluoromethoxy group enhances the electron-withdrawing characteristics of the molecule, potentially affecting its biological activity and interactions with other substances. The indole-2,3-dione moiety indicates that it contains two carbonyl groups, contributing to its potential as a reactive electrophile. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structure and functional groups suggest potential applications in various fields, including agrochemicals and pharmaceuticals, although specific biological activities would require further investigation through experimental studies.
Formula:C9H4F3NO3
InChI:InChI=1S/C9H4F3NO3/c10-9(11,12)16-5-3-1-2-4-6(5)7(14)8(15)13-4/h1-3H,(H,13,14,15)
InChI key:InChIKey=LBLDKICVIXUAFI-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C1=C2C(NC(=O)C2=O)=CC=C1
Synonyms:- 1H-Indole-2,3-dione, 4-(trifluoromethoxy)-
- 4-(Trifluoromethoxy)-1H-indole-2,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
