CAS 959236-56-7

Methyl 4-(hydroxymethyl)-3-thiophenecarboxylate

Description:

Methyl 4-(hydroxymethyl)-3-thiophenecarboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a carboxylate functional group, specifically a methyl ester, which contributes to its reactivity and solubility in organic solvents. The presence of a hydroxymethyl group enhances its potential for further chemical modifications, making it a versatile intermediate in organic synthesis. The thiophene moiety often imparts unique electronic properties, which can be beneficial in applications such as pharmaceuticals, agrochemicals, and materials science. The compound's structure suggests it may exhibit interesting biological activities, although specific biological data would need to be referenced from empirical studies. Additionally, its CAS number, 959236-56-7, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound represents a valuable building block in the synthesis of more complex molecules.

Formula: C₇H₈O₃S

InChI: InChI=1S/C7H8O3S/c1-10-7(9)6-4-11-3-5(6)2-8/h3-4,8H,2H2,1H3

InChI key: InChIKey=GMFPPVRGDDNSAF-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(CO)=CSC1

Synonyms:

• Methyl 4-(hydroxymethyl)-3-thiophenecarboxylate
• 3-Thiophenecarboxylic acid, 4-(hydroxymethyl)-, methyl ester

Methyl 4-(hydroxymethyl)thiophene-3-carboxylate

CAS: 959236-56-7

Versatile small molecule scaffold

Formula: C₇H₈O₃S

Purity: Min. 95%

Molecular weight: 172.2 g/mol

Ref: 3D-JNB23656