CymitQuimica logo

CAS 959236-99-8

:

5-cyclopentylthiophene-2-carbaldehyde

Description:
5-Cyclopentylthiophene-2-carbaldehyde is an organic compound characterized by its unique structure, which includes a thiophene ring substituted with a cyclopentyl group and an aldehyde functional group. The presence of the thiophene ring imparts aromatic properties, while the cyclopentyl group contributes to its hydrophobic characteristics. This compound typically exhibits a yellow to brown color and may have a distinct odor due to the aldehyde group. It is soluble in organic solvents, making it useful in various chemical reactions and applications, particularly in organic synthesis and materials science. The aldehyde functional group allows for further reactivity, enabling it to participate in condensation reactions or serve as a precursor for more complex molecules. Additionally, compounds like 5-cyclopentylthiophene-2-carbaldehyde are of interest in the development of organic electronic materials, such as organic semiconductors and photovoltaic devices, due to their electronic properties. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C10H12OS
InChI:InChI=1/C10H12OS/c11-7-9-5-6-10(12-9)8-3-1-2-4-8/h5-8H,1-4H2
SMILES:C1CCC(C1)c1ccc(C=O)s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.