CAS 959237-03-7

3-(hydroxymethyl)-4-(propan-2-yloxy)benzaldehyde

Description:

3-(Hydroxymethyl)-4-(propan-2-yloxy)benzaldehyde, with the CAS number 959237-03-7, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a hydroxymethyl group (-CH2OH) and a propan-2-yloxy group (-O-CH(CH3)2) attached to the benzene ring, contributing to its unique chemical properties. The presence of the hydroxymethyl group enhances its potential for hydrogen bonding, which can influence its solubility and reactivity. The propan-2-yloxy group, being an ether, provides additional steric hindrance and can affect the compound's overall polarity. This compound may exhibit various chemical behaviors, including reactivity in electrophilic aromatic substitution reactions and potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications in research or industry.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c1-8(2)14-11-4-3-9(6-12)5-10(11)7-13/h3-6,8,13H,7H2,1-2H3

SMILES: CC(C)Oc1ccc(cc1CO)C=O

3-(hydroxymethyl)-4-isopropoxybenzaldehyde

CAS: 959237-03-7

3-(hydroxymethyl)-4-isopropoxybenzaldehyde

Purity: 95%

Molecular weight: 194.23g/mol

Ref: 54-OR927479