CAS 959237-31-1

6-Bromo-N-cyclopentyl-2-pyridinamine

Description:

6-Bromo-N-cyclopentyl-2-pyridinamine is a chemical compound characterized by its unique structure, which includes a bromine atom attached to a pyridine ring and a cyclopentyl group linked to an amine functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the bromine atom may enhance its electrophilic nature, making it a candidate for various chemical reactions, including nucleophilic substitutions. The cyclopentyl group can influence the compound's steric properties and overall molecular conformation, potentially affecting its biological activity and interaction with other molecules. As a pyridinamine, it may also exhibit basic properties due to the nitrogen atom in the pyridine ring, which can participate in hydrogen bonding and coordination with metal ions. Overall, 6-Bromo-N-cyclopentyl-2-pyridinamine is of interest in medicinal chemistry and material science, where its unique structural features may lead to the development of novel therapeutic agents or functional materials.

Formula: C₁₀H₁₃BrN₂

InChI: InChI=1S/C10H13BrN2/c11-9-6-3-7-10(13-9)12-8-4-1-2-5-8/h3,6-8H,1-2,4-5H2,(H,12,13)

InChI key: InChIKey=RYAZRECFYWSHSF-UHFFFAOYSA-N

SMILES: N(C=1N=C(Br)C=CC1)C2CCCC2

Synonyms:

• 6-Bromo-N-cyclopentyl-2-pyridinamine
• 2-Pyridinamine, 6-bromo-N-cyclopentyl-