CAS 959237-42-4

1,2,3,4-Tetrahydro-6-methoxy-2-oxo-4-quinolinecarboxylic acid

Description:

1,2,3,4-Tetrahydro-6-methoxy-2-oxo-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a tetrahydro configuration, indicating that it has a saturated ring system, and includes a methoxy group (-OCH3) and a carboxylic acid group (-COOH), contributing to its reactivity and solubility in polar solvents. The presence of the keto group (C=O) enhances its potential for various chemical reactions, including condensation and nucleophilic attacks. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many quinoline derivatives, it may also possess antimicrobial or anti-inflammatory properties, although specific biological activities would require further investigation. Overall, its structural characteristics and functional groups make it a compound of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₁NO₄

InChI: InChI=1S/C11H11NO4/c1-16-6-2-3-9-7(4-6)8(11(14)15)5-10(13)12-9/h2-4,8H,5H2,1H3,(H,12,13)(H,14,15)

InChI key: InChIKey=CSXKQOMETSMOEJ-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C=2C(=CC=C(OC)C2)NC(=O)C1

Synonyms:

• 4-Quinolinecarboxylic acid, 1,2,3,4-tetrahydro-6-methoxy-2-oxo-
• 1,2,3,4-Tetrahydro-6-methoxy-2-oxo-4-quinolinecarboxylic acid