CAS 959237-71-9
:5-tetrahydrofuran-2-ylthiophene-2-carboxylic acid
Description:
5-Tetrahydrofuran-2-ylthiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a thiophene ring and a tetrahydrofuran moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities. The presence of the thiophene ring contributes to its potential electronic properties, making it of interest in organic electronics and materials science. The tetrahydrofuran group may enhance solubility and stability in various solvents. As a carboxylic acid, it can participate in acid-base reactions and may form esters or amides under appropriate conditions. The compound's molecular interactions can be influenced by hydrogen bonding due to the carboxylic acid group, which may affect its reactivity and biological activity. Additionally, its structural features may allow for applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Overall, 5-tetrahydrofuran-2-ylthiophene-2-carboxylic acid represents a versatile compound with potential utility in various chemical and industrial applications.
Formula:C9H10O3S
InChI:InChI=1/C9H10O3S/c10-9(11)8-4-3-7(13-8)6-2-1-5-12-6/h3-4,6H,1-2,5H2,(H,10,11)
SMILES:C1CC(c2ccc(C(=O)O)s2)OC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.