CAS 959238-03-0
:3-(2-methylpropyl)pyrrolidine
Description:
3-(2-Methylpropyl)pyrrolidine is a cyclic amine characterized by a five-membered ring structure containing four carbon atoms and one nitrogen atom. This compound features a branched alkyl substituent, specifically a 2-methylpropyl group, attached to the nitrogen atom of the pyrrolidine ring. The presence of this substituent influences its physical and chemical properties, such as solubility and boiling point. Pyrrolidine derivatives are known for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological systems. The compound may exhibit basic properties due to the nitrogen atom, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the steric hindrance introduced by the 2-methylpropyl group can affect the compound's reactivity and interaction with other molecules. Overall, 3-(2-methylpropyl)pyrrolidine is of interest in both synthetic organic chemistry and pharmacology, warranting further investigation into its properties and potential applications.
Formula:C8H17N
InChI:InChI=1/C8H17N/c1-7(2)5-8-3-4-9-6-8/h7-9H,3-6H2,1-2H3
SMILES:CC(C)CC1CCNC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.