CymitQuimica logo

CAS 959238-28-9

:

1-(1-Methylethyl)-3-azetidinecarboxylic acid

Description:
1-(1-Methylethyl)-3-azetidinecarboxylic acid, also known by its CAS number 959238-28-9, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the isopropyl group (1-methylethyl) enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds with azetidine rings exhibit interesting biological activities, making them of interest in medicinal chemistry. The specific stereochemistry of the compound can also play a crucial role in its biological interactions and pharmacological properties. Additionally, the compound's stability, reactivity, and potential applications in synthesis or as a pharmaceutical intermediate can be influenced by the presence of the azetidine and carboxylic acid functionalities. Overall, 1-(1-Methylethyl)-3-azetidinecarboxylic acid represents a unique structure that may have diverse applications in chemical research and development.
Formula:C7H13NO2
InChI:InChI=1S/C7H13NO2/c1-5(2)8-3-6(4-8)7(9)10/h5-6H,3-4H2,1-2H3,(H,9,10)
InChI key:InChIKey=GVMUGUGCWQHJGM-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CN(C(C)C)C1
Synonyms:
  • 3-Azetidinecarboxylic acid, 1-(1-methylethyl)-
  • 3-azetidinecarboxylic acid, 1-(1-methylethyl)-
  • 1-Propan-2-ylazetidine-3-carboxylic acid
  • 1-(1-Methylethyl)-3-azetidinecarboxylic acid
  • 1-Isopropylazetidine-3-carboxylic acid
Found 5 products.