CAS 959238-42-7

2-(4-methylmorpholin-2-yl)ethanol

Description:

2-(4-methylmorpholin-2-yl)ethanol, with the CAS number 959238-42-7, is an organic compound characterized by its morpholine structure, which includes a morpholine ring substituted with a methyl group and an ethanol moiety. This compound typically exhibits properties such as being a colorless to pale yellow liquid, with a moderate to high solubility in water due to the presence of the hydroxyl (-OH) group. Its molecular structure suggests it may have hydrogen-bonding capabilities, influencing its interactions with other substances. The presence of the morpholine ring can impart basicity, making it potentially useful in various chemical applications, including as a solvent or in the synthesis of pharmaceuticals. Additionally, the compound may exhibit moderate volatility and a relatively low boiling point, which are common characteristics of small organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₁₅NO₂

InChI: InChI=1/C7H15NO2/c1-8-3-5-10-7(6-8)2-4-9/h7,9H,2-6H2,1H3

SMILES: CN1CCOC(CCO)C1