CymitQuimica logo

CAS 959238-51-8

:

2,5-Dimethyloxazolo[5,4-d]pyrimidin-7(6H)-one

Description:
2,5-Dimethyloxazolo[5,4-d]pyrimidin-7(6H)-one is a heterocyclic compound characterized by its unique fused ring structure, which combines elements of both oxazole and pyrimidine. This compound features a dimethyl substitution at the 2 and 5 positions of the oxazole ring, contributing to its chemical stability and potentially influencing its biological activity. The presence of the carbonyl group at the 7 position enhances its reactivity and solubility in various solvents. Typically, compounds of this nature exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure allows for various interactions with biological targets, which may include enzyme inhibition or receptor modulation. Additionally, the compound's properties such as melting point, solubility, and spectral characteristics (like NMR and IR) can be explored to understand its behavior in different environments. Overall, 2,5-Dimethyloxazolo[5,4-d]pyrimidin-7(6H)-one represents a class of compounds that may have significant implications in drug development and other chemical applications.
Formula:C7H7N3O2
InChI:InChI=1S/C7H7N3O2/c1-3-8-6(11)5-7(9-3)12-4(2)10-5/h1-2H3,(H,8,9,11)
InChI key:InChIKey=AXSUVXXGOZEMQW-UHFFFAOYSA-N
SMILES:O=C1C2=C(OC(C)=N2)NC(C)=N1
Synonyms:
  • 2,5-Dimethyl-6H,7H-[1,3]oxazolo[5,4-d]pyrimidin-7-one
  • 2,5-Dimethyl-6H-[1,3]oxazolo[5,4-d]pyrimidin-7-one
  • 2,5-Dimethyloxazolo[5,4-d]pyrimidin-7(6H)-one
  • 2,5-Dimethyloxazolo[5,4-d]pyrimidin-7-ol
  • Oxazolo[5,4-d]pyrimidin-7(6H)-one, 2,5-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.