CymitQuimica logo

CAS 959238-58-5

:

2,3-Dihydro-5-(4-morpholinyl)-1H-indole

Description:
2,3-Dihydro-5-(4-morpholinyl)-1H-indole is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a morpholine group, a six-membered ring containing both oxygen and nitrogen, which contributes to its biological activity and solubility properties. The presence of the dihydro group indicates that the compound has two hydrogen atoms added to the indole structure, affecting its reactivity and stability. Typically, compounds like this may exhibit pharmacological properties, making them of interest in medicinal chemistry and drug development. The molecular formula and specific stereochemistry can influence its interactions with biological targets, potentially leading to therapeutic applications. Additionally, the compound's solubility, melting point, and other physical properties would be influenced by the functional groups present, which can affect its behavior in various chemical environments. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C12H16N2O
InChI:InChI=1S/C12H16N2O/c1-2-12-10(3-4-13-12)9-11(1)14-5-7-15-8-6-14/h1-2,9,13H,3-8H2
InChI key:InChIKey=TYCOEKCFYZRMAZ-UHFFFAOYSA-N
SMILES:C=1(C=C2C(=CC1)NCC2)N3CCOCC3
Synonyms:
  • 2,3-Dihydro-5-(4-morpholinyl)-1H-indole
  • 1H-Indole, 2,3-dihydro-5-(4-morpholinyl)-
  • 4-(2,3-dihydro-1H-indol-5-yl)morpholine
  • 5-(morpholin-4-yl)-2,3-dihydro-1H-indole
  • 4-(Indolin-5-yl)Morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.