CAS 959238-90-5
:α-(Methoxymethyl)-N-methyl-2-pyridinemethanamine
Description:
α-(Methoxymethyl)-N-methyl-2-pyridinemethanamine, with the CAS number 959238-90-5, is a chemical compound characterized by its pyridine ring structure, which contributes to its basicity and potential for forming hydrogen bonds. This compound features a methoxymethyl group and a methylamine moiety, which can influence its solubility and reactivity. Typically, such compounds exhibit moderate polarity due to the presence of both hydrophobic (aromatic) and hydrophilic (amine and ether) functional groups. The methoxymethyl group may enhance the compound's stability and affect its interaction with biological systems, making it of interest in medicinal chemistry. Additionally, the presence of the nitrogen atom in the pyridine ring can impart unique electronic properties, potentially allowing for various applications in pharmaceuticals or as intermediates in organic synthesis. Overall, the characteristics of this compound suggest it may have specific applications in research or industry, particularly in fields related to drug development or chemical synthesis.
Formula:C9H14N2O
InChI:InChI=1S/C9H14N2O/c1-10-9(7-12-2)8-5-3-4-6-11-8/h3-6,9-10H,7H2,1-2H3
InChI key:InChIKey=CIVVDUQQGKBETN-UHFFFAOYSA-N
SMILES:C(COC)(NC)C1=CC=CC=N1
Synonyms:- 2-Methoxy-N-methyl-1-pyridin-2-ylethanamine
- α-(Methoxymethyl)-N-methyl-2-pyridinemethanamine
- [2-Methoxy-1-(pyridin-2-yl)ethyl](methyl)amine
- 2-Pyridinemethanamine, α-(methoxymethyl)-N-methyl-
- (2-Methoxy-1-pyridin-2-ylethyl)methylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.