CAS 959238-95-0
:2-(Propylamino)-5-pyrimidinecarboxaldehyde
Description:
2-(Propylamino)-5-pyrimidinecarboxaldehyde is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features a propylamino group, which contributes to its basicity and potential reactivity, as well as an aldehyde functional group (-CHO) that is known for its reactivity in condensation reactions and as a reducing agent. The presence of the carboxaldehyde group indicates that it can participate in various chemical reactions, including nucleophilic additions and oxidation. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and industry. Overall, 2-(Propylamino)-5-pyrimidinecarboxaldehyde is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C8H11N3O
InChI:InChI=1S/C8H11N3O/c1-2-3-9-8-10-4-7(6-12)5-11-8/h4-6H,2-3H2,1H3,(H,9,10,11)
InChI key:InChIKey=CDTAUWPTFJUTKJ-UHFFFAOYSA-N
SMILES:N(CCC)C=1N=CC(C=O)=CN1
Synonyms:- 2-(Propylamino)-5-pyrimidinecarboxaldehyde
- 5-Pyrimidinecarboxaldehyde, 2-(Propylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
