CAS 959239-00-0

2-(isopropylamino)pyrimidine-5-carbaldehyde

Description:

2-(Isopropylamino)pyrimidine-5-carbaldehyde is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of the isopropylamino group indicates that there is an isopropyl group attached to an amino group, contributing to the compound's basicity and potential reactivity. The aldehyde functional group at the 5-position of the pyrimidine ring introduces a reactive carbonyl group, making it susceptible to nucleophilic attack and facilitating various chemical reactions, such as condensation and oxidation. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment, due to potential toxicity or reactivity.

Formula: C₈H₁₁N₃O

InChI: InChI=1/C8H11N3O/c1-6(2)11-8-9-3-7(5-12)4-10-8/h3-6H,1-2H3,(H,9,10,11)

SMILES: CC(C)Nc1ncc(cn1)C=O

Synonyms:

• 5-Pyrimidinecarboxaldehyde, 2-[(1-Methylethyl)Amino]-