CAS 959239-06-6

2-(tetrahydrofuran-2-ylmethylamino)pyrimidine-5-carbaldehyde

Description:

2-(Tetrahydrofuran-2-ylmethylamino)pyrimidine-5-carbaldehyde is a chemical compound characterized by its unique structure, which includes a pyrimidine ring, an aldehyde functional group, and a tetrahydrofuran moiety. The presence of the aldehyde group suggests that it can participate in various chemical reactions, such as condensation and oxidation. The tetrahydrofuran ring contributes to the compound's solubility and reactivity, making it potentially useful in organic synthesis and medicinal chemistry. This compound may exhibit biological activity due to its structural features, which could interact with biological targets. Its molecular weight, melting point, and solubility characteristics would depend on the specific conditions and purity of the sample. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use. Overall, 2-(tetrahydrofuran-2-ylmethylamino)pyrimidine-5-carbaldehyde represents a versatile building block in the synthesis of more complex molecules.

Formula: C₁₀H₁₃N₃O₂

InChI: InChI=1/C10H13N3O2/c14-7-8-4-11-10(12-5-8)13-6-9-2-1-3-15-9/h4-5,7,9H,1-3,6H2,(H,11,12,13)

SMILES: C1CC(CNc2ncc(cn2)C=O)OC1