CAS 959239-18-0

N-[(1-ethylpyrrolidin-3-yl)methyl]ethanamine

Description:

N-[(1-ethylpyrrolidin-3-yl)methyl]ethanamine, with the CAS number 959239-18-0, is a chemical compound that belongs to the class of amines. It features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, substituted with an ethyl group and a methyl group linked to an ethanamine moiety. This structure suggests that the compound may exhibit properties typical of both amines and cyclic amines, potentially influencing its reactivity and interaction with biological systems. The presence of the nitrogen atom in the pyrrolidine ring and the amine group may contribute to hydrogen bonding capabilities, affecting solubility and stability in various solvents. Additionally, the compound's molecular structure may allow for interactions with neurotransmitter systems, making it of interest in pharmacological research. However, specific biological activity, toxicity, and other detailed characteristics would require further investigation through empirical studies and data analysis.

Formula: C₉H₂₀N₂

InChI: InChI=1/C9H20N2/c1-3-10-7-9-5-6-11(4-2)8-9/h9-10H,3-8H2,1-2H3

SMILES: CCNCC1CCN(CC)C1

Synonyms:

• 3-pyrrolidinemethanamine, N,1-diethyl-

N-[(1-ethylpyrrolidin-3-yl)methyl]ethanamine

CAS: 959239-18-0

Formula: C₉H₂₀N₂

Purity: 95.0%

Molecular weight: 156.273

Ref: 10-F310335