CymitQuimica logo

CAS 959239-35-1

:

2-pyridyl(tetrahydrofuran-2-yl)methanone

Description:
2-Pyridyl(tetrahydrofuran-2-yl)methanone is an organic compound characterized by its unique structure, which includes a pyridine ring and a tetrahydrofuran moiety. The presence of the pyridine ring imparts basicity and potential for coordination with metal ions, while the tetrahydrofuran component contributes to its solubility in organic solvents. This compound typically exhibits moderate stability under standard conditions, but its reactivity can be influenced by the functional groups present. It may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions, due to the presence of the carbonyl group. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity. Additionally, its properties can be further explored through spectroscopic methods, such as NMR and IR spectroscopy, to confirm its identity and assess purity. Overall, 2-pyridyl(tetrahydrofuran-2-yl)methanone is a versatile compound with interesting chemical behavior and potential applications in various fields.
Formula:C10H11NO2
InChI:InChI=1/C10H11NO2/c12-10(9-5-3-7-13-9)8-4-1-2-6-11-8/h1-2,4,6,9H,3,5,7H2
SMILES:c1ccnc(c1)C(=O)C1CCCO1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.