CymitQuimica logo

CAS 959239-60-2

:

3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-one

Description:
3-Methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-one is an organic compound characterized by its unique structure, which includes a butanone backbone substituted with a triazole ring. This compound features a methyl group at the 3-position of the butanone and a 2-methyl-1,2,4-triazole moiety at the 1-position. The presence of the triazole ring imparts specific chemical properties, such as potential biological activity, making it of interest in pharmaceutical research. The compound is likely to exhibit moderate polarity due to the presence of both hydrophobic (alkyl groups) and hydrophilic (triazole) components. Its molecular structure suggests it may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound may have applications in agrochemicals or as a building block in organic synthesis, given the significance of triazole derivatives in medicinal chemistry. Overall, 3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-one is a compound of interest due to its structural features and potential applications.
Formula:C8H13N3O
InChI:InChI=1/C8H13N3O/c1-6(2)4-7(12)8-9-5-10-11(8)3/h5-6H,4H2,1-3H3
SMILES:CC(C)CC(=O)c1ncnn1C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.