CAS 959239-65-7
:3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-amine
Description:
3-Methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-amine is a chemical compound characterized by its unique structure, which includes a butan-1-amine backbone substituted with a 2-methyl-1,2,4-triazole moiety. This compound features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms, contributing to its potential biological activity. The presence of the amine functional group suggests that it may exhibit basic properties and can participate in hydrogen bonding, influencing its solubility and reactivity. The methyl groups in both the butyl and triazole portions can affect the steric hindrance and electronic properties of the molecule, potentially impacting its interactions with biological targets. Compounds like this are often studied for their pharmacological properties, including antimicrobial or antifungal activities, due to the presence of the triazole ring. Overall, the specific characteristics of this compound, including its molecular weight, melting point, and solubility, would be determined through experimental methods and may vary based on the conditions of synthesis and purification.
Formula:C8H16N4
InChI:InChI=1/C8H16N4/c1-6(2)4-7(9)8-10-5-11-12(8)3/h5-7H,4,9H2,1-3H3
SMILES:CC(C)CC(c1ncnn1C)N
Synonyms:- 3-methyl-1-(1-methyl-1H-1,2,4-triazol-5-yl)-1-butanamine(SALTDATA: FREE)
- 1H-1,2,4-Triazole-5-methanamine, 1-methyl-α-(2-methylpropyl)-
- 3-METHYL-1-(1-METHYL-1H-1,2,4-TRIAZOL-5-YL)-1-BUTANAMINE
- 3-methyl-1-(2-methyl-1,2,4-triazol-3-yl)butan-1-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methyl-1-(1-methyl-1H-1,2,4-triazol-5-yl)butan-1-amine
CAS:Formula:C8H16N4Molecular weight:168.2394
