CAS 959239-77-1
:4-chloro-2-methyl-5-propyl-pyrimidine
Description:
4-Chloro-2-methyl-5-propyl-pyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a propyl group at the 5-position, along with a methyl group at the 2-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential reactivity due to the presence of the chlorine atom, which can participate in nucleophilic substitution reactions. The methyl and propyl groups can influence the compound's lipophilicity and steric hindrance, affecting its biological activity and interactions with other molecules. 4-Chloro-2-methyl-5-propyl-pyrimidine may be of interest in pharmaceutical research and development, particularly in the synthesis of biologically active compounds or as an intermediate in organic synthesis.
Formula:C8H11ClN2
InChI:InChI=1/C8H11ClN2/c1-3-4-7-5-10-6(2)11-8(7)9/h5H,3-4H2,1-2H3
SMILES:CCCc1cnc(C)nc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.