CAS 959239-81-7
:1-(azetidin-3-yl)-2-methyl-piperidine
Description:
1-(Azetidin-3-yl)-2-methyl-piperidine, identified by its CAS number 959239-81-7, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and an azetidine moiety, a four-membered cyclic amine. The presence of a methyl group at the second position of the piperidine ring contributes to its steric and electronic properties. This compound may exhibit interesting pharmacological activities due to its structural resemblance to various biologically active molecules. Its potential applications could span across medicinal chemistry, particularly in the development of new therapeutic agents. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular structure. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems and chemical reactions. Further studies would be necessary to elucidate its full range of properties and potential applications in various fields.
Formula:C9H18N2
InChI:InChI=1/C9H18N2/c1-8-4-2-3-5-11(8)9-6-10-7-9/h8-10H,2-7H2,1H3
SMILES:CC1CCCCN1C1CNC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.