CAS 959240-08-5

4-cyclopropyl-4-methyl-pyrrolidin-2-one

Description:

4-Cyclopropyl-4-methyl-pyrrolidin-2-one, identified by its CAS number 959240-08-5, is a chemical compound characterized by its unique bicyclic structure. It features a pyrrolidinone ring, which is a five-membered lactam, and is substituted with both a cyclopropyl group and a methyl group at the 4-position. This structural arrangement contributes to its potential biological activity and makes it of interest in medicinal chemistry. The presence of the cyclopropyl moiety can influence the compound's steric and electronic properties, potentially affecting its interactions with biological targets. The compound is likely to exhibit moderate solubility in organic solvents, and its stability may vary depending on environmental conditions such as temperature and pH. As with many pyrrolidinones, it may participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Its specific applications and effects would depend on ongoing research and exploration within pharmaceutical and chemical contexts.

Formula: C₈H₁₃NO

InChI: InChI=1/C8H13NO/c1-8(6-2-3-6)4-7(10)9-5-8/h6H,2-5H2,1H3,(H,9,10)

SMILES: CC1(CC(=NC1)O)C1CC1