CAS 959240-19-8

2-(2-furyl)pyrimidine-5-carbaldehyde

Description:

2-(2-Furyl)pyrimidine-5-carbaldehyde is an organic compound characterized by its unique structure, which features a pyrimidine ring substituted with a furyl group and an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide (DMSO). The presence of the aldehyde group makes it reactive, particularly in condensation reactions and as a potential electrophile in various organic synthesis processes. Additionally, the furyl moiety contributes to the compound's aromatic properties, which can influence its reactivity and interactions with other chemical species. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing more complex molecules. As with many organic compounds, handling should be done with care, considering safety protocols to avoid exposure to harmful effects.

Formula: C₉H₆N₂O₂

InChI: InChI=1/C9H6N2O2/c12-6-7-4-10-9(11-5-7)8-2-1-3-13-8/h1-6H

SMILES: c1cc(c2ncc(cn2)C=O)oc1

Synonyms:

• 5-Pyrimidinecarboxaldehyde, 2-(2-Furanyl)-

2-(2-Furyl)-5-pyrimidinecarbaldehyde

CAS: 959240-19-8

2-(2-Furyl)-5-pyrimidinecarbaldehyde

Purity: 95%

Molecular weight: 174.16g/mol

Ref: 54-OR924581

2-(2-Furyl)-5-pyrimidinecarbaldehyde

CAS: 959240-19-8

2-(2-Furyl)-5-pyrimidinecarbaldehyde (2FP) is a novel anticancer activator that belongs to the class of modified DNA. 2FP is a nucleoside analogue that inhibits the synthesis of DNA, RNA, and protein. It has been shown to inhibit the growth of cancer cells in vitro and in vivo. This compound may be used as an antiviral agent against HIV and herpes virus infections. 2FP has high purity and quality, with CAS number 959240-19-8.

Formula: C₉H₆N₂O₂

Purity: Min. 95%

Molecular weight: 174.16 g/mol

Ref: 3D-NF57441