CAS 959240-31-4

[1-(4-methylpiperazin-1-yl)cyclopentyl]methanamine

Description:

[1-(4-methylpiperazin-1-yl)cyclopentyl]methanamine, with the CAS number 959240-31-4, is a chemical compound characterized by its unique structure that includes a cyclopentyl group and a piperazine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of nitrogen atoms. The piperazine ring contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the methyl group on the piperazine enhances its lipophilicity, which can influence its pharmacokinetic properties. Additionally, the cyclopentyl group may affect the compound's conformation and interactions with biological targets. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting various biological pathways. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₁H₂₃N₃

InChI: InChI=1/C11H23N3/c1-13-6-8-14(9-7-13)11(10-12)4-2-3-5-11/h2-10,12H2,1H3

SMILES: CN1CCN(CC1)C1(CCCC1)CN

(1-(4-Methylpiperazin-1-yl)cyclopentyl)methanamine

CAS: 959240-31-4

Formula: C₁₁H₂₃N₃

Molecular weight: 197.3204

Ref: IN-DA00J1R8

1-[1-(4-methyl-1-piperazinyl)cyclopentyl]methanamine

CAS: 959240-31-4

Formula: C₁₁H₂₃N₃

Purity: 95.0%

Molecular weight: 197.326

Ref: 10-F310511