CAS 959240-41-6

2-(2,5-dimethylanilino)-2-oxo-acetic acid

Description:

2-(2,5-Dimethylanilino)-2-oxo-acetic acid, identified by its CAS number 959240-41-6, is an organic compound characterized by its unique structure, which includes an aniline derivative and an oxo-acetic acid moiety. This compound typically exhibits properties associated with both aromatic amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the carboxylic acid functional group. The dimethyl substitution on the aniline ring can influence its electronic properties, potentially enhancing its reactivity or altering its interaction with biological systems. Additionally, the presence of the oxo group contributes to its acidity and may affect its stability under various conditions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility in synthetic applications. However, specific safety and handling guidelines should be followed, as with any chemical substance.

Formula: C₁₀H₁₁NO₃

InChI: InChI=1/C10H11NO3/c1-6-3-4-7(2)8(5-6)11-9(12)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14)

SMILES: Cc1ccc(C)c(c1)NC(=O)C(=O)O

Synonyms:

• [(2,5-Dimethylphenyl)Amino](Oxo)Acetic Acid
• Acetic Acid, 2-[(2,5-Dimethylphenyl)Amino]-2-Oxo-