CAS 959240-56-3

3-(4-methyl-1,2,4-triazol-3-yl)propanoic acid

Description:

3-(4-methyl-1,2,4-triazol-3-yl)propanoic acid is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety attached to a 4-methyl-1,2,4-triazole ring. This compound features both acidic and heterocyclic functionalities, making it of interest in various fields, including pharmaceuticals and agrochemicals. The presence of the triazole ring contributes to its potential biological activity, as triazoles are known for their role in antifungal and antimicrobial agents. The compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid group, while the triazole ring may influence its lipophilicity and interaction with biological targets. Additionally, the methyl group on the triazole ring can affect its steric and electronic properties, potentially enhancing its reactivity or selectivity in chemical reactions. Overall, 3-(4-methyl-1,2,4-triazol-3-yl)propanoic acid represents a versatile structure with potential applications in medicinal chemistry and related fields.

Formula: C₆H₉N₃O₂

InChI: InChI=1/C6H9N3O2/c1-9-4-7-8-5(9)2-3-6(10)11/h4H,2-3H2,1H3,(H,10,11)

SMILES: Cn1cnnc1CCC(=O)O

3-(4-Methyl-4H-1,2,4-triazol-3-yl)propanoic acid

CAS: 959240-56-3

Formula: C₆H₉N₃O₂

Molecular weight: 155.1546

Ref: IN-DA00H694

3-(4-Methyl-4H-1,2,4-triazol-3-yl)propanoic acid

CAS: 959240-56-3

Versatile small molecule scaffold

Formula: C₆H₉N₃O₂

Purity: Min. 95%

Molecular weight: 155.15 g/mol

Ref: 3D-JNB24056