CAS 959240-62-1
:5-(6-chloro-3-pyridyl)-3-methyl-1,2,4-oxadiazole
Description:
5-(6-Chloro-3-pyridyl)-3-methyl-1,2,4-oxadiazole is a heterocyclic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. The compound features a pyridine ring substituted with a chlorine atom at the 6-position and a methyl group at the 3-position of the oxadiazole. This structural arrangement contributes to its unique chemical properties, including potential biological activity. The presence of the chlorine atom can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. The oxadiazole moiety is known for its applications in pharmaceuticals and agrochemicals, often exhibiting antimicrobial and anti-inflammatory properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and material science. Overall, 5-(6-chloro-3-pyridyl)-3-methyl-1,2,4-oxadiazole represents a versatile scaffold for further chemical exploration and development.
Formula:C8H6ClN3O
InChI:InChI=1/C8H6ClN3O/c1-5-11-8(13-12-5)6-2-3-7(9)10-4-6/h2-4H,1H3
SMILES:Cc1nc(c2ccc(Cl)nc2)on1
Synonyms:- 2-Chloro-5-(3-Methyl-1,2,4-Oxadiazol-5-Yl)Pyridine
- Pyridine, 2-Chloro-5-(3-Methyl-1,2,4-Oxadiazol-5-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
