CAS 959240-80-3
:1-methyl-5-oxo-pyrrolidine-3-carbohydrazide
Description:
1-Methyl-5-oxo-pyrrolidine-3-carbohydrazide, identified by its CAS number 959240-80-3, is a chemical compound that features a pyrrolidine ring, which is a five-membered cyclic amine. This compound contains a carbonyl group (oxo) and a hydrazide functional group, contributing to its reactivity and potential biological activity. The presence of the methyl group at the nitrogen position enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The hydrazide moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as hydrazides are often involved in the synthesis of various bioactive compounds. Additionally, the structural characteristics of this compound may allow for hydrogen bonding and other intermolecular interactions, which are crucial for its biological activity. Overall, 1-methyl-5-oxo-pyrrolidine-3-carbohydrazide is of interest for its potential applications in drug development and as a building block in organic synthesis.
Formula:C6H11N3O2
InChI:InChI=1/C6H11N3O2/c1-9-3-4(2-5(9)10)6(11)8-7/h4H,2-3,7H2,1H3,(H,8,11)
SMILES:CN1CC(CC1=O)C(=NN)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.