CAS 959240-87-0

5-amino-1,3-diethyl-6-methyl-benzimidazol-2-one

Description:

5-amino-1,3-diethyl-6-methyl-benzimidazol-2-one is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features amino and diethyl substituents, contributing to its unique properties. The presence of the amino group typically enhances its solubility in polar solvents and may impart basic characteristics. The diethyl groups provide steric bulk, which can influence the compound's reactivity and interaction with biological targets. The methyl group at the 6-position can also affect the compound's electronic properties and sterics. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific applications and interactions would depend on further studies, including its pharmacokinetics and mechanism of action. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.

Formula: C₁₂H₁₇N₃O

InChI: InChI=1/C12H17N3O/c1-4-14-10-6-8(3)9(13)7-11(10)15(5-2)12(14)16/h6-7H,4-5,13H2,1-3H3

SMILES: CCn1c2cc(C)c(cc2n(CC)c1=O)N

5-amino-1,3-diethyl-6-methyl-1,3-dihydro-2H-benzimidazol-2-one

CAS: 959240-87-0

Formula: C₁₂H₁₇N₃O

Purity: 95.0%

Color and Shape: Solid, White powder

Molecular weight: 219.288

Ref: 10-F310767