CAS 959241-06-6
:2-(2,3-dimethylanilino)-2-oxo-acetic acid
Description:
2-(2,3-Dimethylanilino)-2-oxo-acetic acid is an organic compound characterized by its unique structure, which includes an oxo-acetic acid moiety and a dimethylaniline substituent. This compound features a carbonyl group adjacent to a carboxylic acid, contributing to its acidic properties. The presence of the dimethylaniline group suggests potential for aromatic interactions and may influence the compound's solubility and reactivity. Typically, compounds of this nature can exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure may allow for hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point, boiling point, and solubility in various solvents. Additionally, the presence of the dimethyl groups can impact steric hindrance and electronic distribution, potentially influencing the compound's reactivity in chemical reactions. Overall, 2-(2,3-dimethylanilino)-2-oxo-acetic acid is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C10H11NO3
InChI:InChI=1/C10H11NO3/c1-6-4-3-5-8(7(6)2)11-9(12)10(13)14/h3-5H,1-2H3,(H,11,12)(H,13,14)
SMILES:Cc1cccc(c1C)NC(=O)C(=O)O
Synonyms:- [(2,3-Dimethylphenyl)Amino](Oxo)Acetic Acid
- Acetic Acid, 2-[(2,3-Dimethylphenyl)Amino]-2-Oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
