CAS 959241-20-4

1-butanoylpiperidin-4-one

Description:

1-Butanoylpiperidin-4-one, identified by its CAS number 959241-20-4, is a chemical compound that belongs to the class of piperidinones. It features a piperidine ring substituted with a butanoyl group at the nitrogen atom and a ketone functional group at the 4-position. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to various bioactive molecules. The presence of the butanoyl group contributes to its lipophilicity, which can influence its pharmacokinetic properties. Additionally, the piperidine ring is known for its ability to interact with biological targets, making this compound of interest in drug design. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.

Formula: C₉H₁₅NO₂

InChI: InChI=1/C9H15NO2/c1-2-3-9(12)10-6-4-8(11)5-7-10/h2-7H2,1H3

SMILES: CCCC(=O)N1CCC(=O)CC1

Synonyms:

• 4-Piperidinone, 1-(1-Oxobutyl)-

1-Butyrylpiperidin-4-one

CAS: 959241-20-4

Formula: C₉H₁₅NO₂

Molecular weight: 169.2209

Ref: IN-DA005WGZ

1-butyryl-4-piperidinone

CAS: 959241-20-4

Formula: C₉H₁₅NO₂

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 169.224

Ref: 10-F310907

1-Butyrylpiperidin-4-one

Controlled Product

CAS: 959241-20-4

Please enquire for more information about 1-Butyrylpiperidin-4-one including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₁₅NO₂

Purity: Min. 95%

Molecular weight: 169.22 g/mol

Ref: 3D-FB115374