CAS 959241-31-7

(6-chloropyrazin-2-yl)-pyrrolidin-1-yl-methanone

Description:

(6-chloropyrazin-2-yl)-pyrrolidin-1-yl-methanone is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a chlorine atom and a pyrrolidine moiety. The presence of the chloropyrazine group contributes to its potential biological activity, as halogenated compounds often exhibit enhanced interactions with biological targets. The pyrrolidine ring, a five-membered nitrogen-containing heterocycle, is known for its role in various pharmacological agents, providing flexibility and the ability to form hydrogen bonds. This compound may exhibit properties such as lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the methanone functional group suggests potential reactivity, allowing for further chemical modifications. Overall, the combination of these structural features may render (6-chloropyrazin-2-yl)-pyrrolidin-1-yl-methanone of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and applications would require further investigation through experimental studies.

Formula: C₉H₁₀ClN₃O

InChI: InChI=1/C9H10ClN3O/c10-8-6-11-5-7(12-8)9(14)13-3-1-2-4-13/h5-6H,1-4H2

SMILES: C1CCN(C1)C(=O)c1cncc(Cl)n1