CAS 959241-37-3

(6-chloropyrazin-2-yl)-(4-methylpiperazin-1-yl)methanone

Description:

(6-chloropyrazin-2-yl)-(4-methylpiperazin-1-yl)methanone is a chemical compound characterized by its unique structure, which includes a pyrazine ring and a piperazine moiety. The presence of a chlorine atom at the 6-position of the pyrazine ring contributes to its reactivity and potential biological activity. The methanone functional group indicates the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic attacks. This compound is often studied for its pharmacological properties, particularly in the context of drug development, as piperazine derivatives are known for their diverse biological activities, including antipsychotic and antidepressant effects. The molecular structure suggests potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the pyrazine and piperazine rings, which are critical for its application in therapeutic contexts.

Formula: C₁₀H₁₃ClN₄O

InChI: InChI=1/C10H13ClN4O/c1-14-2-4-15(5-3-14)10(16)8-6-12-7-9(11)13-8/h6-7H,2-5H2,1H3

SMILES: CN1CCN(CC1)C(=O)c1cncc(Cl)n1

(6-Chloropyrazin-2-yl)(4-methylpiperazin-1-yl)methanone

CAS: 959241-37-3

(6-Chloropyrazin-2-yl)(4-methylpiperazin-1-yl)methanone

Purity: 95%

Molecular weight: 240.69g/mol

Ref: 54-OR1064787

2-chloro-6-[(4-methyl-1-piperazinyl)carbonyl]pyrazine

CAS: 959241-37-3

Formula: C₁₀H₁₃ClN₄O

Purity: 95.0%

Molecular weight: 240.69

Ref: 10-F311013

2-Chloro-6-(4-methylpiperazine-1-carbonyl)pyrazine

CAS: 959241-37-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃ClN₄O

Purity: Min. 95%

Molecular weight: 240.69 g/mol

Ref: 3D-JNB24137