CAS 959241-50-0

2-(cyclopropylmethylsulfanyl)acetic acid

Description:

2-(Cyclopropylmethylsulfanyl)acetic acid is an organic compound characterized by the presence of a cyclopropyl group and a sulfanyl (thioether) functional group attached to an acetic acid moiety. This compound features a sulfur atom bonded to a cyclopropylmethyl group, which contributes to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions, making it a weak acid. The cyclopropyl group introduces strain and rigidity into the molecular structure, potentially influencing its reactivity and interactions with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, its solubility and stability can be affected by the presence of the sulfur atom and the cyclopropyl ring, which may influence its behavior in various solvents and under different conditions. Overall, 2-(cyclopropylmethylsulfanyl)acetic acid represents a unique structure with potential applications in chemical synthesis and drug development.

Formula: C₆H₁₀O₂S

InChI: InChI=1/C6H10O2S/c7-6(8)4-9-3-5-1-2-5/h5H,1-4H2,(H,7,8)

SMILES: C1CC1CSCC(=O)O

Synonyms:

• [(Cyclopropylmethyl)Sulfanyl]Acetic Acid
• Acetic Acid, 2-[(Cyclopropylmethyl)Thio]-

[(cyclopropylmethyl)thio]acetic acid

CAS: 959241-50-0

Purity: 95.0%

Molecular weight: 146.1999969482422

Ref: 10-F311042