CAS 959241-55-5

2-(6-methyl-2-oxo-indolin-3-yl)acetic acid

Description:

2-(6-Methyl-2-oxo-indolin-3-yl)acetic acid is an organic compound characterized by its indole structure, which features a fused bicyclic system comprising a benzene ring and a pyrrole ring. This compound contains a ketone functional group and an acetic acid moiety, contributing to its acidic properties. The presence of the methyl group at the 6-position of the indole ring enhances its lipophilicity, potentially influencing its biological activity and solubility. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, making it a candidate for further research in drug development and synthesis. As with many organic compounds, its behavior in different environments, such as pH and solvent systems, can significantly affect its properties and applications.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c1-6-2-3-7-8(5-10(13)14)11(15)12-9(7)4-6/h2-4,8H,5H2,1H3,(H,12,15)(H,13,14)

SMILES: Cc1ccc2C(CC(=O)O)C(=Nc2c1)O

(6-methyl-2-oxo-2,3-dihydro-1H-indol-3-yl)acetic acid

CAS: 959241-55-5

Purity: 95.0%

Molecular weight: 205.21299743652344

Ref: 10-F313769