CymitQuimica logo

CAS 959241-61-3

:

2-(7-methyl-2-oxo-indolin-3-yl)acetic acid

Description:
2-(7-methyl-2-oxo-indolin-3-yl)acetic acid, identified by its CAS number 959241-61-3, is a chemical compound that features an indolin-2-one structure, which is characterized by a fused bicyclic system containing a nitrogen atom. This compound typically exhibits properties associated with both acidic and aromatic functionalities due to the presence of the acetic acid moiety and the indole-like structure. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the carboxylic acid group. The compound may exhibit biological activity, as many indole derivatives are known for their pharmacological properties, including anti-inflammatory and anticancer effects. Its molecular structure suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the methyl group can influence its reactivity and stability. Overall, 2-(7-methyl-2-oxo-indolin-3-yl)acetic acid represents a unique compound with potential applications in drug development and research.
Formula:C11H11NO3
InChI:InChI=1/C11H11NO3/c1-6-3-2-4-7-8(5-9(13)14)11(15)12-10(6)7/h2-4,8H,5H2,1H3,(H,12,15)(H,13,14)
SMILES:Cc1cccc2C(CC(=O)O)C(=Nc12)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.