CAS 959245-07-9

methyl 6-cyano-1H-pyrrolo[3,2-b]pyridine-3-carboxylate

Description:

Methyl 6-cyano-1H-pyrrolo[3,2-b]pyridine-3-carboxylate is a chemical compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole moieties. This compound features a cyano group (-CN) and a carboxylate ester (-COOCH3) functional group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, while the ester functionality can undergo hydrolysis or transesterification. Methyl 6-cyano-1H-pyrrolo[3,2-b]pyridine-3-carboxylate is often studied for its biological activity, particularly in the context of drug development, as compounds with similar structures have shown promise in various therapeutic areas. Its molecular properties, such as solubility and stability, are influenced by the functional groups present, making it a subject of interest for further research in synthetic and pharmaceutical chemistry.

Formula: C₁₀H₇N₃O₂

InChI: InChI=1/C10H7N3O2/c1-15-10(14)7-5-12-8-2-6(3-11)4-13-9(7)8/h2,4-5,12H,1H3

SMILES: COC(=O)c1c[nH]c2cc(C#N)cnc12

Methyl 6-cyano-4-azaindole-3-carboxylate

CAS: 959245-07-9

Methyl 6-cyano-4-azaindole-3-carboxylate

Purity: ≥95%

Molecular weight: 201.18g/mol

Ref: 54-OR41129