CAS 959246-87-8
:methyl (E)-2-acetamido-3-(2,5-difluorophenyl)prop-2-enoate
Description:
Methyl (E)-2-acetamido-3-(2,5-difluorophenyl)prop-2-enoate is an organic compound characterized by its unique structural features, including an acetamido group and a difluorophenyl moiety. This compound belongs to the class of acrylate esters, which are known for their reactivity in polymerization processes. The presence of the E configuration indicates that the substituents around the double bond are on opposite sides, influencing its stereochemistry and potentially its biological activity. The difluorophenyl group contributes to the compound's lipophilicity and may enhance its interaction with biological targets. Additionally, the methyl ester functional group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. The compound's CAS number, 959246-87-8, allows for its identification in chemical databases, facilitating research and application in fields such as medicinal chemistry and materials science. Overall, this compound's distinct functional groups and structural characteristics make it of interest for further study and potential applications.
Formula:C12H11F2NO3
InChI:InChI=1/C12H11F2NO3/c1-7(16)15-11(12(17)18-2)6-8-5-9(13)3-4-10(8)14/h3-6H,1-2H3,(H,15,16)/b11-6+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
