CAS 95927-67-6
:(1R,3R,11S,13R,15S,16S,17S,19S,23R,25S,33S,34S,35R,37S,38S,39S,41S)-3,13,15,25,35,37-hexahydroxy-11,33-bis{(1S,2S,3S)-2-hydroxy-5-[(2S,4R,6S)-4-methoxy-6-methyltetrahydro-2H-pyran-2-yl]-1,3-dimethylpentyl}-17,39-dimethoxy-6,12,16,28,34,38-hexamethyl-10,32
Description:
The chemical substance with the name provided is a complex organic compound characterized by a multi-ring structure and numerous functional groups, including multiple hydroxyl (-OH) and methoxy (-OCH3) groups. Its stereochemistry is defined by several chiral centers, indicated by the specific R and S configurations, which contribute to its three-dimensional shape and potentially influence its biological activity. The presence of hexahydroxy and dimethoxy groups suggests that the compound may exhibit significant polarity, affecting its solubility in various solvents. Additionally, the intricate arrangement of methyl groups and the presence of a tetrahydropyran moiety indicate that this compound may have interesting interactions in biological systems, possibly serving as a natural product or a synthetic analog with potential pharmacological properties. The CAS number 95927-67-6 allows for easy identification and retrieval of information regarding this substance in chemical databases. Overall, the complexity of its structure suggests that it may have unique chemical reactivity and potential applications in fields such as medicinal chemistry or biochemistry.
Formula:C78H132O20
InChI:InChI=1/C78H132O20/c1-45-23-29-57(79)37-59-19-17-21-61(95-59)41-71(91-15)52(8)68(82)44-70(84)54(10)78(56(12)76(88)48(4)28-32-64-40-66(90-14)36-50(6)94-64)98-74(86)34-26-46(2)24-30-58(80)38-60-20-18-22-62(96-60)42-72(92-16)51(7)67(81)43-69(83)53(9)77(97-73(85)33-25-45)55(11)75(87)47(3)27-31-63-39-65(89-13)35-49(5)93-63/h17-20,23-26,33-34,47-72,75-84,87-88H,21-22,27-32,35-44H2,1-16H3/b33-25-,34-26+,45-23+,46-24+/t47-,48-,49-,50-,51-,52-,53?,54-,55-,56-,57+,58-,59-,60-,61-,62-,63-,64-,65+,66+,67-,68-,69+,70+,71-,72-,75-,76-,77-,78-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Swinholide A
CAS:Swinholide A: sponge-derived polyketone, actin-binding/dimerizing (Kd ~50 nM), cytotoxic, actin-filament severing, antifungal.Formula:C78H132O20Purity:98%Color and Shape:Less Oil Or Amorphous Solid Colorless Oil Or Amorphous SolidMolecular weight:1389.87

