CAS 959271-96-6
:4-Chloro-6-methoxy-2-(trifluoromethyl)-3-quinolinecarbonitrile
Description:
4-Chloro-6-methoxy-2-(trifluoromethyl)-3-quinolinecarbonitrile is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 4-position, a methoxy group at the 6-position, and a trifluoromethyl group at the 2-position of the quinoline ring, along with a carbonitrile functional group at the 3-position. The presence of these substituents contributes to its unique chemical properties, including potential biological activity and solubility characteristics. The trifluoromethyl group is known to enhance lipophilicity, which can influence the compound's interaction with biological systems. Additionally, the carbonitrile group can participate in various chemical reactions, making this compound of interest in medicinal chemistry and material science. Its specific applications may vary, but compounds with similar structures are often explored for their potential as pharmaceuticals or agrochemicals. Safety and handling precautions should be observed due to the presence of halogenated and nitrile functionalities.
Formula:C12H6ClF3N2O
InChI:InChI=1S/C12H6ClF3N2O/c1-19-6-2-3-9-7(4-6)10(13)8(5-17)11(18-9)12(14,15)16/h2-4H,1H3
InChI key:InChIKey=MJVGKFJOTCTMDJ-UHFFFAOYSA-N
SMILES:ClC=1C2=C(N=C(C(F)(F)F)C1C#N)C=CC(OC)=C2
Synonyms:- 4-Chloro-6-methoxy-2-(trifluoromethyl)-3-quinolinecarbonitrile
- 3-Quinolinecarbonitrile, 4-chloro-6-methoxy-2-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-Chloro-6-methoxy-2-(trifluoromethyl)quinoline-3-carbonitrile
CAS:Formula:C12H6ClF3N2OMolecular weight:286.6370
