
CAS 959275-67-3
:2-Fluoro-N-pentylbenzenamine
Description:
2-Fluoro-N-pentylbenzenamine, identified by its CAS number 959275-67-3, is an organic compound characterized by the presence of a fluorine atom and a pentyl group attached to a benzenamine structure. This compound features a fluorine substituent at the second position of the aromatic ring, which can influence its reactivity and physical properties. The pentyl group, a five-carbon alkyl chain, contributes to the hydrophobic character of the molecule, potentially affecting its solubility in various solvents. The presence of the amine functional group (-NH2) indicates that it can participate in hydrogen bonding, which may enhance its solubility in polar solvents. Additionally, the fluorine atom can impart unique electronic properties, making the compound of interest in various chemical applications, including pharmaceuticals and agrochemicals. Overall, 2-Fluoro-N-pentylbenzenamine exhibits a combination of hydrophobic and polar characteristics, which can influence its behavior in chemical reactions and interactions with biological systems.
Formula:C11H16FN
InChI:InChI=1S/C11H16FN/c1-2-3-6-9-13-11-8-5-4-7-10(11)12/h4-5,7-8,13H,2-3,6,9H2,1H3
InChI key:InChIKey=MPDWVNBIVBYGEN-UHFFFAOYSA-N
SMILES:N(CCCCC)C1=C(F)C=CC=C1
Synonyms:- Benzenamine, 2-fluoro-N-pentyl-
- 2-Fluoro-N-pentylbenzenamine
- 2-Fluoro-N-pentylaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.