
CAS 95933-75-8
:Benzenecarboximidamide, N,3,4,5-tetrahydroxy-, hydrochloride (1:1)
Description:
Benzenecarboximidamide, N,3,4,5-tetrahydroxy-, hydrochloride (1:1), with the CAS number 95933-75-8, is a chemical compound characterized by its complex structure that includes a benzenecarboximidamide moiety and multiple hydroxyl groups. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The hydroxyl groups contribute to its potential as a hydrogen bond donor, influencing its reactivity and interactions with other molecules. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require empirical measurement or detailed literature references for precise values. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C7H8N2O4·ClH
InChI:InChI=1S/C7H8N2O4.ClH/c8-7(9-13)3-1-4(10)6(12)5(11)2-3;/h1-2,10-13H,(H2,8,9);1H
InChI key:InChIKey=KBKNXSNOQYLIRI-UHFFFAOYSA-N
SMILES:C(NO)(=N)C1=CC(O)=C(O)C(O)=C1.Cl
Synonyms:- Benzenecarboximidamide, N,3,4,5-tetrahydroxy-, monohydrochloride
- Benzenecarboximidamide, N,3,4,5-tetrahydroxy-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.