CAS 959421-96-6

Methyl 3,4-dihydro-5-methyl-1(2H)-quinolinecarboxylate

Description:

Methyl 3,4-dihydro-5-methyl-1(2H)-quinolinecarboxylate, with the CAS number 959421-96-6, is a chemical compound that belongs to the class of quinoline derivatives. This substance typically exhibits a bicyclic structure characterized by a fused benzene and pyridine ring, which contributes to its unique chemical properties. The presence of a carboxylate group indicates that it can participate in various chemical reactions, including esterification and nucleophilic substitutions. The methyl groups in its structure can influence its solubility and reactivity, making it potentially useful in organic synthesis and medicinal chemistry. Additionally, compounds of this type may exhibit biological activity, which could be of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, Methyl 3,4-dihydro-5-methyl-1(2H)-quinolinecarboxylate represents a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₂H₁₅NO₂

InChI: InChI=1S/C12H15NO2/c1-9-5-3-7-11-10(9)6-4-8-13(11)12(14)15-2/h3,5,7H,4,6,8H2,1-2H3

InChI key: InChIKey=NRAJSCNQUNQFEG-UHFFFAOYSA-N

SMILES: C(OC)(=O)N1C=2C(CCC1)=C(C)C=CC2

Synonyms:

• 1(2H)-Quinolinecarboxylic acid, 3,4-dihydro-5-methyl-, methyl ester
• Methyl 3,4-dihydro-5-methyl-1(2H)-quinolinecarboxylate

Methyl 5-methyl-3,4-dihydroquinoline-1(2H)-carboxylate

CAS: 959421-96-6

Formula: C₁₂H₁₅NO₂

Molecular weight: 205.2530

Ref: IN-DA01ED7S