
CAS 959430-10-5
:3-Amino-1-(2-propen-1-yl)-1H-pyrazole-4-carboxamide
Description:
3-Amino-1-(2-propen-1-yl)-1H-pyrazole-4-carboxamide is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of a propenyl group indicates that it has unsaturation, which can influence its reactivity and interactions with other molecules. The compound is likely to exhibit polar characteristics due to the amino and carboxamide groups, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of new drugs, as pyrazole derivatives are often explored for their biological activities. Additionally, the compound's solubility and stability in various solvents can vary, impacting its utility in different chemical environments. Overall, 3-Amino-1-(2-propen-1-yl)-1H-pyrazole-4-carboxamide represents a versatile scaffold for further chemical modifications and investigations in medicinal chemistry.
Formula:C7H10N4O
InChI:InChI=1S/C7H10N4O/c1-2-3-11-4-5(7(9)12)6(8)10-11/h2,4H,1,3H2,(H2,8,10)(H2,9,12)
InChI key:InChIKey=YZLFBXJRCIMLGW-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CN(CC=C)N=C1N
Synonyms:- 1-Allyl-3-amino-1H-pyrazole-4-carboxamide
- 1H-Pyrazole-4-carboxamide, 3-amino-1-(2-propen-1-yl)-
- 3-Amino-1-(2-propen-1-yl)-1H-pyrazole-4-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.